5-chloro-2-nitrobenzoic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

5-chloro-2-nitrobenzoic acid; 2-nitro-5-chlorobenzoic acid
CAS RN:[2516-95-2]
Formula:C7H4ClNO4; 201.57 g/mol
InChiKey:ZKUYSJHXBFFGPU-UHFFFAOYSA-N
SMILES:OC(=O)c1cc(Cl)ccc1[N+]([O-])=O
Molecular structure of 5-chloro-2-nitrobenzoic acid
Melting point:138 °C
Log10 partition octanol / water:2.13

Isomers

2-chloro-3-nitrobenzoic acid
Molecular structure of 2-chloro-3-nitrobenzoic acid
2-chloro-4-nitrobenzoic acid
Molecular structure of 2-chloro-4-nitrobenzoic acid
2-chloro-5-nitrobenzoic acid
Molecular structure of 2-chloro-5-nitrobenzoic acid
2-chloro-6-nitrobenzoic acid
Molecular structure of 2-chloro-6-nitrobenzoic acid
3-chloro-2-nitrobenzoic acid
Molecular structure of 3-chloro-2-nitrobenzoic acid
4-chloro-2-nitrobenzoic acid
Molecular structure of 4-chloro-2-nitrobenzoic acid
4-chloro-3-nitrobenzoic acid
Molecular structure of 4-chloro-3-nitrobenzoic acid
5-chloro-2-nitrobenzoic acid
Molecular structure of 5-chloro-2-nitrobenzoic acid
4-nitrophenyl chloroformate
Molecular structure of 4-nitrophenyl chloroformate
  ::